Snakes and similar animals are members of a group called reptiles.

How do reptiles differ from other animals?

Answers

Answer 1

Answer:

They have skin covered with scales.


Related Questions

hello~i will really appreciate it if you answer all this♡


1.How many valence electrons do noble gases like Ne,Ar and Kr have?

a.1.
b.2
c.6
d.7

2.The following describe ionic bonding,EXCEPT____.

a.It involves the transfer of electrons.

b.It involves sharing of electrons.

c.atoms either gain or lose electrons.

d.It is a bond between a metal and a non-metal.

3.Which of the following pairs of atoms is most likely to form a covalent compound?

a.C,O
b.Na,O
c.Mg,Br
d.Ba,CI

4.Which of the following is a metal?

a.O
b.S
c.K
d.C

5.Which is not a type of a chemical bonding?

a. Polar bonding
b.Metallic bonding
c.ionic bonding
d.covalent

||. A. Use Lewis structures to show . the transfer of electrons in the given combinations.

1.K +Br
2.Ba + I
3.Be + O
4.Na + S
5.AI + F

B.What ionic charge will the following elements have?PLEASE JUSTIFY YOUR ANSWER.

1. Group 2A
2. Group 5A
3.Group 6A

C.Predict whether the bonding in the oxides of the following elements is covalent or ionic.EXPLAIN YOUR ANSWER.

1.Aluminum
2.Magnesium
3.Phosphorus
4.silicon
5.sodium

|||. Write the electron configuration of the following elements.

1. Ti
2. V
3. Se
4. Ag
5. Zr

thank you!
to your hardwork★

Answers

Explanation:

1)Noble gases have stable valence electron of 2 and 8.

2)B- ionic compounds do not require sharing of electron.

3)B- sodium and oxygen will likely form a covalent compound.

4) C- potassium

5) A- polar bonding

6)

The relative formula mass (M) of a Group 2 metal carbonate is 197
Relative atomic masses (Ar): C = 12
O = 16
Calculate the relative atomic mass (Ar) of the Group 2 metal in the metal carbonate
Name the Group 2 metal.​

Answers

The relative atomic mass (Ar) : 137 and the element : Ba

Further explanation

The naming of chemical compounds is giving a special name to a compound that aims to facilitate the classification of compounds and facilitate the identification of a compound. The rules for naming chemical compounds have been determined by the IUPAC (International Union of Pure and Applied Chemistry)

This nomenclature includes the naming of ion compounds, covalent compounds, and polyatomic

The molar mass of a compound is given by the sum of the relative atomic mass of Ar  

M AxBy = (x.Ar A + y. Ar B)  

Group 2 metals have a +2 charge : M²⁺

So the compound of metal carbonate : MCO₃

Ar C = 12, O = 16

M MCO₃ = (1.Ar M + 1. Ar C+ 3. Ar O)  

[tex]\tt 197=1. Ar~M+1.12+3.16\\\\197=Ar~M+12+48\\\\Ar~M=137[/tex]

The element with relative atomic masses 137 is Ba

So the compound : BaCO₃

Can anyone explain to me how I solve 3x10^8 / 3.82x10^-7
I know the answer due to referring to the key but I'm not sure how they got it. Answer was 7.85x10^14

Answers

Answer:

You have to do this on a calculator. So when you put it in the calculator you will get 7.85x10^14.

3x10^8 is the speed of light. 3.82x10^-7 is the number in the question.

You can solve it like this

3x10^8

------------------        

3.82x10^7                  

But you would do this on a calculator.

Formula for all possible isomers of hexane​

Answers

Answer:

1) n-Hexane. 2) 2-Methyl pentane(IUPAC name) or Isohexane(common name). 3) 2,2-Dimethylbutane(IUPAC name) or Neohexane(common name). 4) 3-Methylpentane

Explanation:

Which changes involve forming or breaking chemical bonds?

A.burning and digesting

B.boiling and melting

C.burning and melting

D.rusting and cutting

Answers

Answer:

d

Explanation:

i took the test

Which option is a mixture? a.carbon dioxide b. air c. oxygen d. carbon

Answers

The answer would be A.) carbon dioxide

Answer:

Air

Explanation:

Did test 100

If an unknown sample contains 39.04% sulfuric acid by mass, then a 0.9368 g of that sample would require _____ mL of 0.2389 M NaOH for neutralization.
A) 31.22
B) 39.98
C) 7.80
D) 79.96
E) 15.61

Please give an answer and an explanation, thanks!

Answers

Answer:

A) 31.22

Explanation:

The reaction of sulfuric acid with NaOH is:

H₂SO₄ + 2 NaOH → Na₂SO₄ + 2H₂O

To solve this problem we need to determine the moles of acid that will react, and, using the chemical equation we can determine the moles of NaOH and the volume that a 0.2389M NaOH solution would require to neutralize it.

Moles H₂SO₄ (Molar mass: 98.08g/mol):

0.9368g * 39.04% = 0.3657g H₂SO₄ * (1mol / 98.08g) =

3.7289x10⁻³moles H₂SO₄

And moles of NaOH that you require to neutralize the acid are:

3.7289x10⁻³moles H₂SO₄ * (2 moles NaOH / 1 mole H₂SO₄) =

7.4578x10⁻³ moles NaOH

Using a 0.2389M NaOH solution:

7.4578x10⁻³ moles NaOH * (1L / 0.2389mol) = 0.03122L = 31.22mL

Right answer is:

A) 31.22

how many molecules are in CO²​

Answers

Answer:

53.11× 10²³ molecules

Explanation:

Given data:

Number of molecules of CO₂ = ?

Mass of CO₂ = 388.1 g

Solution:

Formula:

Number of moles = mass/ molar mass

Molar mass of CO₂ = 12× 1 + 16×2

Molar mass of CO₂ = 44 g/mol

Now we will put the values in formula.

Number of moles = 388.1 g/ 44 g/mol

Number of moles = 8.82 moles

Now we will calculate the number of molecules by using Avogadro number.

It is the number of atoms , ions and molecules in one gram atom of element, one gram molecules of compound and one gram ions of a substance.

The number 6.022 × 10²³ is called Avogadro number.

1 mole = 6.022 × 10²³ molecules

8.82 mol × 6.022 × 10²³ molecules / 1 mol

53.11× 10²³ molecules

Brainliest plz?

Answer:

Now times by Abogadros constant: 1* 6.022*10^23=6.022*10^23 molecules of CO2 are present.

Explanation:

We know the molar mass of CO2(g) is 44.01⋅g⋅mol−1 . And so Avogadro's number of carbon dioxide molecules have this mass... And we take the product of the quotient... Molecules of carbon dioxide=5.00⋅mol×6.022×1023⋅mol−1≅30×1023⋅carbon dioxide molecules.

can anybody help me? ill mark brainliest!!! please ITS TIMED

Answers

Density = Mass/Volume but it can also be rearranged to:

Mass = Volume x Density

Given in the question:

Volume - 44.9 cc

Density - 19.3 g/cc

Calculation

Mass = Volume x Density

= 44.9 x 19.3

= 866.57 g

Which energy transformations occur when a candle burns?
Thermal energy transforms into mechanical energy and radiant energy.
Chemical energy transforms into thermal energy and electrical energy.
Thermal energy transforms into radiant energy and chemical energy
Chemical energy transforms into thermal energy and radiant energy.

Answers

Answer:

D - Chemical energy transforms into thermal energy and radiant energy

Explanation:

Correct on edge 2020

Answer:

(D)

Explanation:

Chemical energy transforms into thermal energy and radiant energy.

.) If a solution had a pH level of 13.2, it would be considered a:
O A. strong base
O B. weak base
O C. strong acid
O D. weak acid

Answers

A pH level of 13.2 would be a very strong base!
A is the correct answer.

Remember, the high pH numbers are bases and the low ones are acidic.

Which contribution is a modification to Thomson's plum pudding model?

Atoms are indivisible.
Electrons are scattered in an atom.
A positively charged nucleus sits at the center of an atom.
Atoms of the same element have the same properties.

Answers

Answer:

Option C: A positively charged nucleus sits at the center of an atom.

Explanation:

Thompson’s plum pudding model was a model proposed by Thompson to show that an atom consisted of more than one fundamental unit.

In Thompson's model, he suggested that the atom consisted of a cloud of positive charges which were surrounded by electrons which are negative charges distributed throughout.

Now, Thompson's experiment was later rejected by Ernest Rutherford when he carried out the gold foil experiment and came to the conclusion where he proposed a model that the atom consisted of mainly empty space and that all its positive charge are concentrated at its center and further surrounded by a cloud of electrons.

From the given options, the correct one is Option C.

Answer: Option C: A positively charged nucleus sits at the center of an atom.

Explanation:

The most important ELEMENT found in all living things is


A. Oxygen

B. hydrogen

C. Nitrogen

D. Carbon

Answers

Answer:

A. Carbon hope this helps

Answer:

D. Carbon. I guess that's the answer

Calculate the entropy change when 4.31 g of H2 reacts with O2 according to the reaction

2 H2(g) + O2(g) → 2 H2O(l)

at 298 K and 1 atm pressure. The standard molar enthalpy of formation of H2O(l) at 298 K is −285.8 kJ/mol. The corresponding free energy of formation is −237.2 kJ/mol.

Answer in units of J/K.

Answers

Answer:

Explanation:

ΔG  =  Δ H - T ΔS

Given , ΔG = -237.2 kJ / mol

Δ H = - 285.8 kJ / mol

T = 298

Putting the values in the equation

-237.2 = - 285.8 - 298 x ΔS

ΔS  = .163 kJ / mole K

moles of water formed = 4.31 / 2 = 2.155

entropy change required = 2.155 x .163 kJ / K

= 351.26 J / K .

BE FIRST TO ANSWER FOR SUM GOOD!!!!!:D

Answers

Answer is B can you like btw??

40POINTS AND BRAINLIEST Discuss the orders in which electrons are filled in the s and d subshells of the first three elements in group11​

Answers

Step 1: add electrons to fill the 1s subshell (maximum of 2 electrons), when this is full, go to step 2. Step 2: add electrons to fill the 2s subshell (maximum of 2 electrons), when this is full, go to step 3. Step 3: add electrons to fill the 2p subshell (maximum of 6 electrons), when this is full, go to step 4. Step 4: add electrons to fill the 3s subshell (maximum of 2 electrons), when this is full, go to step 5. Step 5: add electrons to fill the 3p subshell (maximum of 6 electrons), when this is full, go to step 6. Step 6: add electrons to the 4s subshell (maximum of 2 electrons), when this is full, go to step 7. Step 7: add electrons to the 3d subshell (maximum of 10 electrons), when this is full, go to step 8. Step 8: add electrons to the 4p subshell (maximum of 6 electrons), when this is full, go to step 9. etc

So for Cu would be: 1s^22s^22p^63s^23p^63d^9

Ag would be: 1s^22s^22p^63s^23p^63d^104s^24p^64d^105s^1

Au would be: 1s^22s^22p^63s^23p^63d^104s^24p^64d^105s^25p^64f^145d^106s^1

a sample of alcohol has a density 0.82 g/ml.what is the mass of 5500 mL of the alcohol

Answers

Answer:

The answer is 4510 g

Explanation:

The mass of a substance when given the density and volume can be found by using the formula

mass = Density × volume

From the question

density = 0.82 g/mL

volume = 5500 mL

We have

mass = 0.82 × 5500

We have the final answer as

4510 g

Hope this helps you

An unknown metal has a density of 10.51 g/ml and a mass of 287.8 g. What is the
unknown metal's volume?

Answers

Answer:

27.3834443387 so B

Explanation:

M/D=V

287.8/10.51=V

V=27.3834443387

Answer:

27.38

Explanation:

287.8 Divided by 10.51 = 27.38

Please mark brainliest if helped

please help!! my grades dying
15 points

Answers

Answers-in-bold:

There are two common temperature scales. On the Fahrenheit scale, water freezes at 32 degrees. The Celsius scale divides the interval between the freezing and boiling points of water into 100 degrees.

Helium gas (He) is an element and not a compound. Why is this true?

Answers

If we fill up a balloon with just helium gas, it will only contain helium atoms.

Please help I’ll give brainiest!

Answers

Answer:

Im sorry if u get it worng but is it the 3rd one?

Explanation:

The unknown element (Johnsonium, Jo) contains three naturally occurring isotopes. The relative abundances and atomic mass are:
Moorium-36: abundance = 1.32%, mass = 35.978amu
Moorium-38: abundance = 3.25%, mass = 37.963amu
Moorium-40: abundance = 95.43%, mass = 39.962amu
What is the average atomic mass of "Moorium?"

Answers

Answer:

Average atomic mass of moorium is 39.844 amu.

Explanation:

Given data:

Atomic mass of moorium-36 = 35.978 amu

Relative abundance of  moorium-36 = 1.32%

Atomic mass of moorium-38 = 37.963 amu

Relative abundance of  moorium-38 = 3.25%

Atomic mass of moorium-40 = 39.962 amu

Relative abundance of  moorium-38 = 95.43%

Solution:

Average atomic mass moorium = (abundance of 1st isotope × its atomic mass) +(abundance of 2nd isotope × its atomic mass)+ (abundance of 3rd isotope × its atomic mass)  / 100

Average atomic mass of moorium = (1.32×35.978)+(3.25×37.963)+(95.43×39.962) /100

Average atomic mass of moorium =  47.491 + 123.380 +3813.574  / 100

Average atomic mass of moorium = 3984.445 / 100

Average atomic mass of moorium = 39.844 amu

2. Which atom is larger, Na or Al? Explain why.

Answers

Answer:

Na

Explanation:

Because it has the highest protons and electrons(Atomic mass)

Which noble gases is closest to magnesium? On the periodic table? What must happen if a magnesium atom for it to have an electron arrangement similar to that of a noble gas?

Answers

Answer:

Neon and loose electrons

Explanation:

Magnesium has an electron configuration of 2e 8e 2e, and Neon is 2e,8e. For Mg to have a similar electron arrangement it must loose its two valence electrons and make it an ion.

Answer:

Noble neon gas is the closest.

Explanation:

noble Neon  gas

The Magnesium would have to lose two electrons

Which is a dominant trait that Mendel observed in pea plant

A. Bumpy pods

B. Short height

C. Yellow seeds

D. White flowers

it is not A

Answers

Answer:

C, yellow seeds

Explanation:

In Mandel's studies, he proved that yellow seeds were to be dominant and green seeds were to be recessive.

Answer:

c. yellow seeds

Explanation:

i toke the test

Find the mass of an object that has a density of 1.5g/cm^3 and has a volume of 8cm^3 power

Answers

Answer:

The answer is 12 g

Explanation:

The mass of a substance when given the density and volume can be found by using the formula

mass = Density × volume

From the question

volume = 8 cm³

density = 1.5 g/cm³

We have

mass = 8 × 1.5

We have the final answer as

12 g

Hope this helps you

Which one of the following is the symbol used in a chemical equation for a
gas?
A. (g)
B. (aq)
C. (gas)
D. (a)

Answers

Answer:

A. (g)

Explanation:

Since it asks for a gas, it is A.

Answer:

A (g)

Explanation:

Which action would cause the chair to move to the left?
A. Applying 100 N of force to the chair from the left
B. Applying 100 N of force to the chair from the right
C. Applying 200 N of force to the chair from the right
D. Applying 200 N of force to the chair from the left
SUBMIT
PREVIOUS

Answers

the answer should be c
i’m not for sure but i hope this helps!
In order to overcome static friction, a force greater than 175 N would have to be applied to the chair, leaving only C and D as possible options. Since you want to move the chair to the left, you’d have to push from the right so the answer is
C) applying 200 N of force to the chair from the right

How has cooperation played a role in life's major evolutionary transitions?

Answers

Answer:

The cooperation of a species is shown throughout history. Including in our history. Where it be physical evolution or technological. We have helped each other with building, advice, locations, Reproduction, etc.

5. What is a hypothesis and how is it used?

Answers

Answer: a supposition or proposed explanation made on the basis of limited evidence as a starting point for further investigation.

A hypothesis is used in an experiment to define the relationship between two variables. The purpose of a hypothesis is to find the answer to a question. A formalized hypothesis will force us to think about what results we should look for in an experiment. The first variable is called the independent variable

i hopes this helps :)

Other Questions
Read this excerpt from Little Brother and answer the following questions in complete sentences using proper grammar and punctuation:Marcus manages to flag down a vehicle and they get more than they bargained for...It was a military-looking Jeep, like an armored Hummer, only it didn't have any military insignia on it. The car skidded to a stop just in front of me, and I jumped back and lost my balance and ended up on the road. I felt the doors open near me, and then saw a confusion of booted feet moving close by. I looked up and saw a bunch of military-looking guys in coveralls, holding big, bulky rifles and wearing hooded gas masks with tinted face-plates.I barely had time to register them before those rifles were pointed at me. I'd never looked down the barrel of a gun before, but everything you've heard about the experience is true. You freeze where you are, time stops, and your heart thunders in your ears. I opened my mouth, then shut it, then, very slowly, I held my hands up in front of me.The faceless, eyeless armed man above me kept his gun very level. I didn't even breathe. Van was screaming something and Jolu was shouting and I looked at them for a second and that was when someone put a coarse sack over my head and cinched it tight around my windpipe, so quick and so fiercely I barely had time to gasp before it was locked on me. I was pushed roughly but dispassionately onto my stomach and something went twice around my wrists and then tightened up as well, feeling like baling wire and biting cruelly. I cried out and my own voice was muffled by the hood.I was in total darkness now and I strained my ears to hear what was going on with my friends. I heard them shouting through the muffling canvas of the bag, and then I was being impersonally hauled to my feet by my wrists, my arms wrenched up behind my back, my shoulders screaming.I stumbled some, then a hand pushed my head down and I was inside the Hummer. More bodies were roughly shoved in beside me."Guys?" I shouted, and earned a hard thump on my head for my trouble. I heard Jolu respond, then felt the thump he was dealt, too. My head rang like a gong."Hey," I said to the soldiers. "Hey, listen! We're just high school students. I wanted to flag you down because my friend was bleeding. Someone stabbed him." I had no idea how much of this was making it through the muffling bag. I kept talking. "Listenthis is some kind of misunderstanding. We've got to get my friend to a hospital"Someone went upside my head again. It felt like they used a baton or somethingit was harder than anyone had ever hit me in the head before. My eyes swam and watered and I literally couldn't breathe through the pain. A moment later, I caught my breath, but I didn't say anything. I'd learned my lesson.In three to five sentences, explain Marcus' current stage of identity development. Use examples from the text. As a reminder, the different stages of identity development are: (20 points)Identity Diffusion occurs when an adolescent does not make a commitment to any particular roles, values, or goals.Identity Foreclosure occurs when someone makes a commitment without considering other possibilities.Identity Moratorium occurs when an individual is in the midst of a crisis over a particular role or value and tries out alternatives in order to make a commitment.Identity Achievement occurs when someone makes a personal decision or commitment after going through a crisis and exploring his or her options. I WILL MARK U BRAINLIESTWhy did ancient Egypt begin to trade more with other regions? pls someone help me with the worksheet below p.s im in grade 5 not college Im confused help please please help! newton's laws. please give a legit answer 2/9x + 3 > 4 5/9what graph shows the values that satisfy the expression Could someone help me out pls? Im taking a test and Id love help on this thanks A chemical equation is balanced if there are ______ ______ of each kind of ______________________ on both sides of the equation. which one of these reduce fraction? -What does it means Government as Contract?Another effect of the Great Awakening on colonial culture was the growth of the notion of the state (country) as a contract with the people. Parishioners during the revival gained an understanding of covenant/contract with their churches; they argued that each believer owed the church their obedience, and churches, in turn, owed their congregants the duty to be faithful to the Gospel. Parishioners, therefore, reserved the right to dissolve the covenant and to break ties with the church without prior permission. This notion of a covenant was a popular one in Puritan society and reflected a common/same biblical understanding of association. Present in the Mayflower Compact and later forming an ideological basis for breaking from Great Britain, the notion of covenant grew to link religion and politics in the colonies. The Ideals/beliefs of Puritanical covenant theology were manifested/showed in the Social compact of the Declaration of Independence . Under this belief, implicit/ hidden in the Declaration, disassociated/separation individuals in the state of nature agree to live and to be bound together under the same government. With the frequency by which believersbroke away from larger churches to form splinter groups, the colonists must have been accustomed to separating themselves from larger institutions/organizations such that of the king. Is -12 divided by -5 a rational number or irrational Consider the following debate between two students about their answer to the above question. Student 1: I thought that whenever one object exerts a force on a second object, the second object also exerts a force that is equal in strength, but in the other direction. So even though Earth is bigger and more massive than the Moon, they still pull on each other with a gravitational force of the same strength, just in different directions. Student 2: I disagree. I said that Earth exerts the stronger force because it is way bigger than the Moon. Because its mass is bigger, the gravitational force Earth exerts has to be bigger too. I think you are confusing Newton's third law with the law of gravity. Do you agree or disagree with either or both of the students? My BooThere's always that one personThat will always have your heartYou never see it comingCause you're blinded from the startKnow that you're that one for meIt's clear for everyone to seeOoh babyYou gotta rock your way with this oneOoh you will always be my booCome on[Alicia:]I don't know bout you allBut I know about us and uhIt's the only wayWe know how to rockI don't know bout you allBut I know about us and uhIt's the only wayWe know how to rock[Usher:]Do you remember girlI was the one who gave you your first kissCause I remember girlI was the one who said put your lips like thisEven before all the fame andPeople screaming your nameGirl I was there when you were my baby[Usher:]It started when we were youngerYou were mine my booNow another brother's taken overBut it's still in your eyes my booEven though we used to argue it's alrightIt's alright girl my boo that's OKI know we haven't seen each otherIn awhile but you will always be my boo[Alicia:]I was in love with you when we were youngerYou were mine my booWhen I see you from time to timeI still feel like my booAnd I can see it no matterHow I try to hide my booEven though there's another man who's in my lifeYou will always be my boo[Alicia:]Yes I remember boyCause after we kissedI could only think about your lipsYes I remember boyThe moment I knew you were the oneI could spend my life withEven before all the fameAnd people screaming your nameI was there and you were my baby[Usher:]It started when we were youngerYou were mine my booNow another brother's taken overBut it's still in your eyes my booEven though we used to argue it's alrightIt's alright my boo it's OKI know we haven't seen each otherIn awhile but you will always be my boo[Alicia:]I was in love with you when we were youngerYou were mine my booWhen I see you from time to timeI still feel like my booAnd I can see it no matterHow I try to hide my booEven though there's another man who's in my lifeYou will always be my boo[Usher:]My oh, my oh, my oh, my oh, my boo[Alicia:]My oh, my oh, my oh, my oh, my boo[Usher:]It started when we were youngerYou were mine my booNow another brother's taken overBut it's still in your eyes my booEven though we used to argue it's alrightIt's alright it's OKI know we haven't seen each otherIn awhile but you will always be my boo[Alicia and Usher:]I don't know bout you allBut I know about us and uhIt's the only wayWe know how to rockI don't know bout you allBut I know about us and uhIt's the only wayWe know how to rockIt started when we were youngerMy booNow another brother's taken overMy boo I need help in MATH!!!!!!!!!! Solve6x + 5 = 3x + 14 Which expression is equivalent to sin(20)cos(80) cos(20)sin(80)?sin(60)cos(60)cos(60)sin(60) Select the correct answer.Who answers the three economic questions in a command economy?O A. societyOB.governmentO c.businessesOD.market Scientists in a lab are working with two different samples of the element mercury. They know that the different samples are different isotopes.Which property of the isotopes must be different?a. the atomic numberb. the electric chargec. the element named. the mass number A train goes at a constant speed. If it covers 150 miles in 2 1 2 hours,What distance would it cover in 7 hours? Which African American was the first black person to get a doctorate from Harvard university