Answer:
Fatty Acids
A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.
Saturated Fatty Acids
In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.
Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.
Unsaturated Fatty Acids
In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.
Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.
Lipids and Diet
Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.
Fructose is a simple carbohydrate sugar, while triglycerides are the lipids or the fats of the body. Thus, option C is accurate.
What are triglycerides and fructose?Triglycerides are lipids of the body that are formed of fatty acids and glycerols. It makes the body fat of the animals and of the plants. They are stored in cells for future use and provide energy when needed.
Fructose is a monomer that is the simplest carbohydrate sugar and is generally found in sugarcane, honey, watermelon, grapes, apples, etc.
Therefore, option C. fructose is sugar and triglyceride is fat is correct.
Learn more about triglycerides and fats here:
https://brainly.com/question/17576593
#SPJ2
A sample of Ammonia gas at 650mmHg and 15 degree has a mass of 56.8g.calculate the volume occupied by the gas. Take N=14, H=1,R=8.3145jk.
Answer:
The first thing we have to do is change and state all the units so that we can use our ideal gas law equation ([tex]PV = nRT[/tex]).
650 mmHg is a pressure unit, we have to convert this to kiloPascals. We know that 760 mmHg gives us 101 kPa.
[tex]650 \ mmHg \ * \ \frac{101kPa}{760 mmHg} = 86 \ kPa[/tex]
P = 86kPa
T = 15°C + 273K = 288K
R (Gas constant) = 8.31 kj/mol
Molar mass of Ammonia ([tex]NH_{3}[/tex]) = (1 x 3) + (14) = 17g/mol
n (moles) = [tex]\frac{mass}{molar \ mass}[/tex] [tex]= \frac{56.8}{17} =[/tex] 3.34 mol
V = ?
Rearrange the equation to solve for Volume:
[tex]V = \frac{nRT}{P}[/tex]
Substitute the values inside:
V = [tex]\frac{(3.34)(8.31)(288)}{(86)} = 93 L (rounded)[/tex]
Therefore 93 L of volume is occupied by the ammonia gas.
True or False? The energy carried by a sound
wave is blocked by collisition
between the particles in the
material the name is traveling
in
Answer:
true
Explanation:
i checked on moogle
Helpp you will get a brainly
HC= Hydrocarbon
CH=benzene
Explanation:
HC is Hydrocarbon, how? -- Hydrocarbon, a category of substances consisting only of hydrogen and carbon.
CH is benzene, how? -- benzene is represented by the empirical formula CH, which indicates that a typical sample of the compound contains one atom of carbon (C) to one atom of hydrogen (H).
----(Is this what you meant???)
Sources of error in colorimetry?
Types of Reaction
A) Synthesis
B) Decomposition
C) Single displacement
D) Double displacement
E) Combustion
F - Synthesis
G - Single Displacement
H - Combustion
I - Double Displacement
Hope it helps :)
Pb2O4 has a ratio of 2:4. It needs to be reduced to?
A.) 1:0
B.) 2:0
C.) 1:2
D.) 2:2
Answer:
C
Explanation:
The reason why is because if you divide 2 by 2 you get 1 and 4 divided by 2 is 2. Hope this helps .
True or false: The
louder you yell into a
megaphone in space,
the more likely it is for
the sound waves to
travel.
Answer:
True
Explanation:
This is known as a lapse rate. When you shout something to someone across the lake, the sound waves near the surface end up moving faster than the sound waves higher up. Since the speed is greatest near the ground, sound waves bend upward, causing the audio to be just out of ears reach.
How do carbon atoms form many organic compounds
Carbon has four valence electrons, so it can achieve a full outer energy level by forming four covalent bonds. When it bonds only with hydrogen, it forms compounds called hydrocarbons. Carbon can form single, double, or triple covalent bonds with other carbon atoms.
a wrong
b wrong
c right
d wrong
Determine the highest occupied energy level in the
following elements:
a. He
b. Be
c. Al
d. Ca
e. Sn
Is bleach liquid starch?
Yes or No
Answer:
O it's not
Explanation:
Have a great day!
100 POINTS PLZZ HELPP
draw the correct structural formula for the following molecules
Answer:
I cant see the questions can u do a picture zoomed in, thanks :)
Explanation:
What is the formula of sulfur diphosphide
[tex] \huge \rm \ \blue \:{ \overbrace{ \underbrace{ \tt{ \color{red}{ \: \: \: \: \: \: answer \: \: \: \: \: \: }}}}}[/tex]
[tex] \huge \color{darkblue}P₂S_{5}[/tex]
hope it helpsAnswer:
P2S5
Explanation:
which two observers would be experiencing the same apparent solar time?
The observers which would experience the same apparent solar time are observer B and observer E. This means the correct response as per the full question indicated in the attached document is number 2.
Types of Solar TimeThere are two types of Solar Time. They are:
Apparent Solar Time and Mean Solar TimeWhat is Apparent Solar Time?Apparent solar time refers to the time of the day that is shown by the hour angle of the sun. It is also defined as the sun's position in the sky going by direct observation. Direction observation of the sun to determine Solar Time is possible using a Sundial.
See the link below for more about Apparent Solar Time:
https://brainly.com/question/6336054
select the best explanation for why methanol, ch3oh, cannot be used as a solvent for the deprotonation of a terminal alkyne by sodium amide, nanh2.
Answer:
d. Methanol is more acidic than the alkyne and will be deprotonated instead.
Explanation:
because acidity is the ability to lose H+, leaving an anion behind; acidity depends on the stability of the anion.
Give an example for the neutralisation between a strong acid and a weak base, also mention the nature of its salt.
need help !! ~~~~
Answer:
Neutralization occurs when a strong acid and a strong base come together in a chemical reaction to form water and salt.
Explanation:
not sure huhuhu
You are studying the boiling points of liquids with some fellow students. You have two liquids of different molecular weights, and you test each of them twice. You find that the one with a lower molecular weight also has a lower boiling point. You would like to be more confident with the pattern you are noticing. What are two possible next steps? In one to two sentences, give specific, different examples of how the experiment could be extended, assessed, or improved.
The boiling points of two or three other pairs of liquids in which one liquid has a lower molecular mass than the other can be studied in order to see if the pattern is consistent.
The boiling point of a substance refers to the temperature at which its vapor pressure is equal to the atmospheric pressure. The boiling point of a substance has a lot to do with its molecular mass.
Generally, substances that has a higher molecular mass has a higher boiling point except other factors at at work. In order to confirm whether the pattern that you are noticing about molecular weights and boiling point is consistent, three other liquids with different molecular masses, one being higher than the other can be studied and their boiling points compared.
Learn more about boiling points: https://brainly.com/question/2153588
what would happen if we lost our planets core on earth blew up, would we all die or will we lose gravity or suficate, pls help. :I
Answer: if we lost our core it would be an entire fallout like fallout 76 we would have no way to protect ourselves from the radiation of space except for a select few that actually own astronaut suits tho we would not turn into monsters, sadly :( I wanna be a ghoul
nomenclature of this compound
Answer:
Nomenclature is the process of naming chemical compounds with different names so that they can be easily identified as separate chemicals. Inorganic compounds are compounds that do not deal with the formation of carbohydrates, or simply all other compounds that do not fit into the description of an organic compound.
Explanation:
Do you think the amount of fat will affect its melting point?
how much evaporated milk equals 1 cup of whole milk?
Answer:
1/2 cup evaporated milk plus 1/2 cup water.
Explanation:
The painkiller, Advil® contains the active ingredient ibuprofen (IB), which has a pKb of
5.20. If the pH of a solution containing a dissolved tablet of Advil® was found to be
8.20, what was the equilibrium concentration (mol/L) of ibuprofen?
IB + H2O ⇀ IBH+ + OH−
A) 3.7 × 10−4
B) 5.5 × 10−5
C) 2.8 × 10−7
D) 4.0 × 10−7
E) 9.2 × 10−7
This problem is providing the basic dissociation constant of ibuprofen (IB) as 5.20, its pH as 8.20 and is requiring the equilibrium concentration of the aforementioned drug by giving the chemical equation at equilibrium it takes place. The obtained result turned out to be D) 4.0 × 10−7 M, according to the following work:
First of all, we set up an equilibrium expression for the given chemical equation at equilibrium, in which water is omitted for it is liquid and just aqueous species are allowed to be included:
[tex]Kb=\frac{[IBH^+][OH^-]}{[IB]}[/tex]
Next, we calculate the concentration of hydroxide ions and the Kb due to the fact that both the pH and pKb were given:
[tex]pOH=14-8.20=5.80[/tex]
[tex][OH^-]=10^{-5.8}=1.585x10^{-6}M[/tex]
[tex]Kb=10^{-5.20}=6.31x10^{-6}[/tex]
Then, since the concentration of these ions equal that of the conjugated acid of the ibuprofen (IBH⁺), we can plug in these and the Kb to obtain:
[tex]6.31x10^{-6}=\frac{(1.585x10^{-6})(1.585x10^{-6})}{[IB]}[/tex]
Finally, we solve for the equilibrium concentration of ibuprofen:
[tex][IB]=\frac{(1.585x10^{-6})(1.585x10^{-6})}{6.31x10^{-6}}=4.0x10^{-7}[/tex]
Learn more:
(Weak base equilibrium calculation) https://brainly.com/question/9426156
Please what the element it is
Answer:
Helium
Explanation:
One electron shell is shown in the model of Helium drawn by Bohr, and it has two electrons inside of it. The atomic number of helium is 2, so the number of protons and electrons that can be used to make its Bohr diagram is the same as its number.
why is oxygen more electronegative than hydrogen
Answer:
The attraction of the Oxygen for an electron as measured by the electronegativity of Oxygen is 3.5 which is higher than the electronegativity of Hydrogen at 2.2
Explanation:
How many grams of CO2 are produced using 0.29 moles of O2?
The mass of CO2 produced using 0.29 moles of O2 is 12.76 grams.
The reaction between carbon and pxygen atom is exprssed as:
C + O2 -> CO2From he balanced equation, we can see that 1 mole O2 reacted to produce 1 mole of CO2.Hence if 0.29 moles of CO2 was used in the reaction, the number of moles of CO2 produced will be 0.29 moles as well.Mass of CO2 = number of moles * molar mass
Mass of CO2 = 0.29 * (12 + 32)
Mass of CO2 = 0.29 * 44
Mass of CO2 = 12.76grams
Hence the mass of CO2 produced using 0.29 moles of O2 is 12.76 grams.
learn more on stoichiometry here: https://brainly.com/question/16060199
in sequence from highest to lowest temperature: A) Lithosphere; B) Mantle; C) Core
PLEASE HELP I AM FAILING
Answer:
160.3 g S
Explanation: there you go
if a substance has a normal boiling point of 50 °c, what can you state about the vapor pressure of the same substance at 40 0 °c?
11. Bacteria and dead cells are removed from circulatory
fluid in the
A) urinary bladder
C) alveoli
B) gallbladder
D) lymph nodes
To solve this we must be knowing each and every concept related to lymph node. Therefore, the correct option is option D among all the given options.
What is lymph nodes?A lymph node, sometimes known as a lymphatic gland, is indeed a kidney-shaped lymphatic and immune system component. The lymphatic veins connect a massive amount of lymph nodes to one another throughout the body.
Most lymph nodes lie within the trunk adjacent to other major structures in the body - such as the paraaortic lymph nodes and the tracheobronchial lymph nodes. The lymphatic drainage patterns are different from person to person and even asymmetrical on each side of the same body. Bacteria and dead cells are removed from circulatory fluid in the lymph nodes.
Therefore, the correct option is option D.
To know more about lymph nodes, here:
https://brainly.com/question/29829253
#SPJ2
Does pure water conduct electricity? If not, what can we do to make it conduct electricity?.
!!!SOMEONE HELP !!!
PLEASE
Answer:
use other websites u might have luck and find ur anwer
Explanation:
(
−
5
2
)
−
1
(
−
5
+
1
)
=
24
−
4
=
−
6
(−5+1)
(−5
2
)−1
=
−4
24
=−6